C12H14F3NO3 — CID 87027979
N-(3-ethoxyphenyl)-2-(2,2,2-trifluoroethoxy)acetamide (PubChem CID 87027979) has the molecular formula C12H14F3NO3 and a molecular weight of 277.24 g/mol. Its IUPAC name is N-(3-ethoxyphenyl)-2-(2,2,2-trifluoroethoxy)acetamide.
| Compound Name | N-(3-ethoxyphenyl)-2-(2,2,2-trifluoroethoxy)acetamide |
|---|---|
| PubChem CID | 87027979 |
| Molecular Formula | C12H14F3NO3 |
| Molecular Weight | 277.24 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | N-(3-ethoxyphenyl)-2-(2,2,2-trifluoroethoxy)acetamide |
| SMILES | CCOc1cccc(NC(=O)COCC(F)(F)F)c1 |
| InChI | InChI=1S/C12H14F3NO3/c1-2-19-10-5-3-4-9(6-10)16-11(17)7-18-8-12(13,14)15/h3-6H,2,7-8H2,1H3,(H,16,17) |
| InChIKey | HJOUQDSVBOHVNL-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.24 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |