C24H33NO3 — CID 17098209
2-(2,4-ditert-butylphenoxy)-N-(3-ethoxyphenyl)acetamide (PubChem CID 17098209) has the molecular formula C24H33NO3 and a molecular weight of 383.53 g/mol. Its IUPAC name is 2-(2,4-ditert-butylphenoxy)-N-(3-ethoxyphenyl)acetamide.
| Compound Name | 2-(2,4-ditert-butylphenoxy)-N-(3-ethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 17098209 |
| Molecular Formula | C24H33NO3 |
| Molecular Weight | 383.53 g/mol |
| Exact Mass | 383.25 |
| IUPAC Name | 2-(2,4-ditert-butylphenoxy)-N-(3-ethoxyphenyl)acetamide |
| SMILES | CCOc1cccc(NC(=O)COc2ccc(C(C)(C)C)cc2C(C)(C)C)c1 |
| InChI | InChI=1S/C24H33NO3/c1-8-27-19-11-9-10-18(15-19)25-22(26)16-28-21-13-12-17(23(2,3)4)14-20(21)24(5,6)7/h9-15H,8,16H2,1-7H3,(H,25,26) |
| InChIKey | QVDVIVGUVPOAIP-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.53 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |