C29H34N2O3 — CID 17234915
N-[3-[[2-(2,4-ditert-butylphenoxy)acetyl]amino]phenyl]benzamide (PubChem CID 17234915) has the molecular formula C29H34N2O3 and a molecular weight of 458.60 g/mol. Its IUPAC name is N-[3-[[2-(2,4-ditert-butylphenoxy)acetyl]amino]phenyl]benzamide.
| Compound Name | N-[3-[[2-(2,4-ditert-butylphenoxy)acetyl]amino]phenyl]benzamide |
|---|---|
| PubChem CID | 17234915 |
| Molecular Formula | C29H34N2O3 |
| Molecular Weight | 458.60 g/mol |
| Exact Mass | 458.26 |
| IUPAC Name | N-[3-[[2-(2,4-ditert-butylphenoxy)acetyl]amino]phenyl]benzamide |
| SMILES | CC(C)(C)c1ccc(OCC(=O)Nc2cccc(NC(=O)c3ccccc3)c2)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C29H34N2O3/c1-28(2,3)21-15-16-25(24(17-21)29(4,5)6)34-19-26(32)30-22-13-10-14-23(18-22)31-27(33)20-11-8-7-9-12-20/h7-18H,19H2,1-6H3,(H,30,32)(H,31,33) |
| InChIKey | ZMPVKKVLRVUIMX-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.60 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |