C24H32N2O3 — CID 17356745
N'-[2-(2,4-ditert-butylphenoxy)acetyl]-2-phenylacetohydrazide (PubChem CID 17356745) has the molecular formula C24H32N2O3 and a molecular weight of 396.53 g/mol. Its IUPAC name is N'-[2-(2,4-ditert-butylphenoxy)acetyl]-2-phenylacetohydrazide.
| Compound Name | N'-[2-(2,4-ditert-butylphenoxy)acetyl]-2-phenylacetohydrazide |
|---|---|
| PubChem CID | 17356745 |
| Molecular Formula | C24H32N2O3 |
| Molecular Weight | 396.53 g/mol |
| Exact Mass | 396.24 |
| IUPAC Name | N'-[2-(2,4-ditert-butylphenoxy)acetyl]-2-phenylacetohydrazide |
| SMILES | CC(C)(C)c1ccc(OCC(=O)NNC(=O)Cc2ccccc2)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C24H32N2O3/c1-23(2,3)18-12-13-20(19(15-18)24(4,5)6)29-16-22(28)26-25-21(27)14-17-10-8-7-9-11-17/h7-13,15H,14,16H2,1-6H3,(H,25,27)(H,26,28) |
| InChIKey | SEIAATZDNVDJCU-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.53 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|