C25H33BrN2O4 — CID 17356768
N'-[2-(2-bromo-4-methylphenoxy)acetyl]-2-(2,4-ditert-butylphenoxy)acetohydrazide (PubChem CID 17356768) has the molecular formula C25H33BrN2O4 and a molecular weight of 505.45 g/mol. Its IUPAC name is N'-[2-(2-bromo-4-methylphenoxy)acetyl]-2-(2,4-ditert-butylphenoxy)acetohydrazide.
| Compound Name | N'-[2-(2-bromo-4-methylphenoxy)acetyl]-2-(2,4-ditert-butylphenoxy)acetohydrazide |
|---|---|
| PubChem CID | 17356768 |
| Molecular Formula | C25H33BrN2O4 |
| Molecular Weight | 505.45 g/mol |
| Exact Mass | 504.16 |
| IUPAC Name | N'-[2-(2-bromo-4-methylphenoxy)acetyl]-2-(2,4-ditert-butylphenoxy)acetohydrazide |
| SMILES | Cc1ccc(OCC(=O)NNC(=O)COc2ccc(C(C)(C)C)cc2C(C)(C)C)c(Br)c1 |
| InChI | InChI=1S/C25H33BrN2O4/c1-16-8-10-21(19(26)12-16)32-15-23(30)28-27-22(29)14-31-20-11-9-17(24(2,3)4)13-18(20)25(5,6)7/h8-13H,14-15H2,1-7H3,(H,27,29)(H,28,30) |
| InChIKey | LAYMEZICOYXBMU-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.45 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|