C33H46Br2N4O6 — CID 4922528
1-N',9-N'-bis[2-(2-bromo-4-tert-butylphenoxy)acetyl]nonanedihydrazide (PubChem CID 4922528) has the molecular formula C33H46Br2N4O6 and a molecular weight of 754.56 g/mol. Its IUPAC name is 1-N',9-N'-bis[2-(2-bromo-4-tert-butylphenoxy)acetyl]nonanedihydrazide.
| Compound Name | 1-N',9-N'-bis[2-(2-bromo-4-tert-butylphenoxy)acetyl]nonanedihydrazide |
|---|---|
| PubChem CID | 4922528 |
| Molecular Formula | C33H46Br2N4O6 |
| Molecular Weight | 754.56 g/mol |
| Exact Mass | 752.18 |
| IUPAC Name | 1-N',9-N'-bis[2-(2-bromo-4-tert-butylphenoxy)acetyl]nonanedihydrazide |
| SMILES | CC(C)(C)c1ccc(OCC(=O)NNC(=O)CCCCCCCC(=O)NNC(=O)COc2ccc(C(C)(C)C)cc2Br)c(Br)c1 |
| InChI | InChI=1S/C33H46Br2N4O6/c1-32(2,3)22-14-16-26(24(34)18-22)44-20-30(42)38-36-28(40)12-10-8-7-9-11-13-29(41)37-39-31(43)21-45-27-17-15-23(19-25(27)35)33(4,5)6/h14-19H,7-13,20-21H2,1-6H3,(H,36,40)(H,37,41)(H,38,42)(H,39,43) |
| InChIKey | GYEZYVKQDOVFCP-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 134.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 754.56 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|