C32H36Br2N4O4 — CID 4922524
2-(2-bromo-4-tert-butylphenoxy)-N-[[4-[[[2-(2-bromo-4-tert-butylphenoxy)acetyl]hydrazinylidene]methyl]phenyl]methylideneamino]acetamide (PubChem CID 4922524) has the molecular formula C32H36Br2N4O4 and a molecular weight of 700.47 g/mol. Its IUPAC name is 2-(2-bromo-4-tert-butylphenoxy)-N-[[4-[[[2-(2-bromo-4-tert-butylphenoxy)acetyl]hydrazinylidene]methyl]phenyl]methylideneamino]acetamide.
| Compound Name | 2-(2-bromo-4-tert-butylphenoxy)-N-[[4-[[[2-(2-bromo-4-tert-butylphenoxy)acetyl]hydrazinylidene]methyl]phenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 4922524 |
| Molecular Formula | C32H36Br2N4O4 |
| Molecular Weight | 700.47 g/mol |
| Exact Mass | 698.11 |
| IUPAC Name | 2-(2-bromo-4-tert-butylphenoxy)-N-[[4-[[[2-(2-bromo-4-tert-butylphenoxy)acetyl]hydrazinylidene]methyl]phenyl]methylideneamino]acetamide |
| SMILES | CC(C)(C)c1ccc(OCC(=O)NN=Cc2ccc(C=NNC(=O)COc3ccc(C(C)(C)C)cc3Br)cc2)c(Br)c1 |
| InChI | InChI=1S/C32H36Br2N4O4/c1-31(2,3)23-11-13-27(25(33)15-23)41-19-29(39)37-35-17-21-7-9-22(10-8-21)18-36-38-30(40)20-42-28-14-12-24(16-26(28)34)32(4,5)6/h7-18H,19-20H2,1-6H3,(H,37,39)(H,38,40) |
| InChIKey | CIAZSZBMPOHGPB-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.47 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|