C22H27BrN2O5 — CID 6231186
2-(2-bromo-4-tert-butylphenoxy)-N-[(Z)-(3,4,5-trimethoxyphenyl)methylideneamino]acetamide (PubChem CID 6231186) has the molecular formula C22H27BrN2O5 and a molecular weight of 479.37 g/mol. Its IUPAC name is 2-(2-bromo-4-tert-butylphenoxy)-N-[(Z)-(3,4,5-trimethoxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-(2-bromo-4-tert-butylphenoxy)-N-[(Z)-(3,4,5-trimethoxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 6231186 |
| Molecular Formula | C22H27BrN2O5 |
| Molecular Weight | 479.37 g/mol |
| Exact Mass | 478.11 |
| IUPAC Name | 2-(2-bromo-4-tert-butylphenoxy)-N-[(Z)-(3,4,5-trimethoxyphenyl)methylideneamino]acetamide |
| SMILES | COc1cc(/C=N\NC(=O)COc2ccc(C(C)(C)C)cc2Br)cc(OC)c1OC |
| InChI | InChI=1S/C22H27BrN2O5/c1-22(2,3)15-7-8-17(16(23)11-15)30-13-20(26)25-24-12-14-9-18(27-4)21(29-6)19(10-14)28-5/h7-12H,13H2,1-6H3,(H,25,26)/b24-12- |
| InChIKey | XWPHHRRYFNOZLZ-MSXFZWOLSA-N |
| XLogP | 4.30 |
| TPSA | 78.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.37 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|