C24H30Br2N2O4 — CID 19208172
4-(2-bromo-4-tert-butylphenoxy)-N-[(E)-(3-bromo-4-ethoxy-5-methoxyphenyl)methylideneamino]butanamide (PubChem CID 19208172) has the molecular formula C24H30Br2N2O4 and a molecular weight of 570.32 g/mol. Its IUPAC name is 4-(2-bromo-4-tert-butylphenoxy)-N-[(E)-(3-bromo-4-ethoxy-5-methoxyphenyl)methylideneamino]butanamide.
| Compound Name | 4-(2-bromo-4-tert-butylphenoxy)-N-[(E)-(3-bromo-4-ethoxy-5-methoxyphenyl)methylideneamino]butanamide |
|---|---|
| PubChem CID | 19208172 |
| Molecular Formula | C24H30Br2N2O4 |
| Molecular Weight | 570.32 g/mol |
| Exact Mass | 568.06 |
| IUPAC Name | 4-(2-bromo-4-tert-butylphenoxy)-N-[(E)-(3-bromo-4-ethoxy-5-methoxyphenyl)methylideneamino]butanamide |
| SMILES | CCOc1c(Br)cc(/C=N/NC(=O)CCCOc2ccc(C(C)(C)C)cc2Br)cc1OC |
| InChI | InChI=1S/C24H30Br2N2O4/c1-6-31-23-19(26)12-16(13-21(23)30-5)15-27-28-22(29)8-7-11-32-20-10-9-17(14-18(20)25)24(2,3)4/h9-10,12-15H,6-8,11H2,1-5H3,(H,28,29)/b27-15+ |
| InChIKey | OINYEUPJTSVEEI-JFLMPSFJSA-N |
| XLogP | 6.23 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.32 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|