C27H31BrN2O3 — CID 19208179
4-(2-bromo-4-tert-butylphenoxy)-N-[(E)-(2-ethoxynaphthalen-1-yl)methylideneamino]butanamide (PubChem CID 19208179) has the molecular formula C27H31BrN2O3 and a molecular weight of 511.46 g/mol. Its IUPAC name is 4-(2-bromo-4-tert-butylphenoxy)-N-[(E)-(2-ethoxynaphthalen-1-yl)methylideneamino]butanamide.
| Compound Name | 4-(2-bromo-4-tert-butylphenoxy)-N-[(E)-(2-ethoxynaphthalen-1-yl)methylideneamino]butanamide |
|---|---|
| PubChem CID | 19208179 |
| Molecular Formula | C27H31BrN2O3 |
| Molecular Weight | 511.46 g/mol |
| Exact Mass | 510.15 |
| IUPAC Name | 4-(2-bromo-4-tert-butylphenoxy)-N-[(E)-(2-ethoxynaphthalen-1-yl)methylideneamino]butanamide |
| SMILES | CCOc1ccc2ccccc2c1/C=N/NC(=O)CCCOc1ccc(C(C)(C)C)cc1Br |
| InChI | InChI=1S/C27H31BrN2O3/c1-5-32-24-14-12-19-9-6-7-10-21(19)22(24)18-29-30-26(31)11-8-16-33-25-15-13-20(17-23(25)28)27(2,3)4/h6-7,9-10,12-15,17-18H,5,8,11,16H2,1-4H3,(H,30,31)/b29-18+ |
| InChIKey | GLRJAHNBGOIMLU-RDRPBHBLSA-N |
| XLogP | 6.61 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.46 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|