C23H23BrN2O3 — CID 135588897
2-(2-bromo-4-tert-butylphenoxy)-N-[(E)-(2-hydroxynaphthalen-1-yl)methylideneamino]acetamide (PubChem CID 135588897) has the molecular formula C23H23BrN2O3 and a molecular weight of 455.35 g/mol. Its IUPAC name is 2-(2-bromo-4-tert-butylphenoxy)-N-[(E)-(2-hydroxynaphthalen-1-yl)methylideneamino]acetamide.
| Compound Name | 2-(2-bromo-4-tert-butylphenoxy)-N-[(E)-(2-hydroxynaphthalen-1-yl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 135588897 |
| Molecular Formula | C23H23BrN2O3 |
| Molecular Weight | 455.35 g/mol |
| Exact Mass | 454.09 |
| IUPAC Name | 2-(2-bromo-4-tert-butylphenoxy)-N-[(E)-(2-hydroxynaphthalen-1-yl)methylideneamino]acetamide |
| SMILES | CC(C)(C)c1ccc(OCC(=O)N/N=C/c2c(O)ccc3ccccc23)c(Br)c1 |
| InChI | InChI=1S/C23H23BrN2O3/c1-23(2,3)16-9-11-21(19(24)12-16)29-14-22(28)26-25-13-18-17-7-5-4-6-15(17)8-10-20(18)27/h4-13,27H,14H2,1-3H3,(H,26,28)/b25-13+ |
| InChIKey | FBOAABAWKNKSGB-DHRITJCHSA-N |
| XLogP | 5.13 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.35 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|