C20H20BrF3N2O2 — CID 4925212
2-(2-bromo-4-tert-butylphenoxy)-N-[[2-(trifluoromethyl)phenyl]methylideneamino]acetamide (PubChem CID 4925212) has the molecular formula C20H20BrF3N2O2 and a molecular weight of 457.29 g/mol. Its IUPAC name is 2-(2-bromo-4-tert-butylphenoxy)-N-[[2-(trifluoromethyl)phenyl]methylideneamino]acetamide.
| Compound Name | 2-(2-bromo-4-tert-butylphenoxy)-N-[[2-(trifluoromethyl)phenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 4925212 |
| Molecular Formula | C20H20BrF3N2O2 |
| Molecular Weight | 457.29 g/mol |
| Exact Mass | 456.07 |
| IUPAC Name | 2-(2-bromo-4-tert-butylphenoxy)-N-[[2-(trifluoromethyl)phenyl]methylideneamino]acetamide |
| SMILES | CC(C)(C)c1ccc(OCC(=O)NN=Cc2ccccc2C(F)(F)F)c(Br)c1 |
| InChI | InChI=1S/C20H20BrF3N2O2/c1-19(2,3)14-8-9-17(16(21)10-14)28-12-18(27)26-25-11-13-6-4-5-7-15(13)20(22,23)24/h4-11H,12H2,1-3H3,(H,26,27) |
| InChIKey | DYRZDCOFLWJSAY-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.29 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|