C21H24BrClN2O2 — CID 19208111
4-(2-bromo-4-tert-butylphenoxy)-N-[(E)-(3-chlorophenyl)methylideneamino]butanamide (PubChem CID 19208111) has the molecular formula C21H24BrClN2O2 and a molecular weight of 451.79 g/mol. Its IUPAC name is 4-(2-bromo-4-tert-butylphenoxy)-N-[(E)-(3-chlorophenyl)methylideneamino]butanamide.
| Compound Name | 4-(2-bromo-4-tert-butylphenoxy)-N-[(E)-(3-chlorophenyl)methylideneamino]butanamide |
|---|---|
| PubChem CID | 19208111 |
| Molecular Formula | C21H24BrClN2O2 |
| Molecular Weight | 451.79 g/mol |
| Exact Mass | 450.07 |
| IUPAC Name | 4-(2-bromo-4-tert-butylphenoxy)-N-[(E)-(3-chlorophenyl)methylideneamino]butanamide |
| SMILES | CC(C)(C)c1ccc(OCCCC(=O)N/N=C/c2cccc(Cl)c2)c(Br)c1 |
| InChI | InChI=1S/C21H24BrClN2O2/c1-21(2,3)16-9-10-19(18(22)13-16)27-11-5-8-20(26)25-24-14-15-6-4-7-17(23)12-15/h4,6-7,9-10,12-14H,5,8,11H2,1-3H3,(H,25,26)/b24-14+ |
| InChIKey | XNMBOHFXXHSNAV-ZVHZXABRSA-N |
| XLogP | 5.71 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.79 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|