C19H30BrNO2 — CID 19201307
4-(2-bromo-4-tert-butylphenoxy)-N-pentylbutanamide (PubChem CID 19201307) has the molecular formula C19H30BrNO2 and a molecular weight of 384.36 g/mol. Its IUPAC name is 4-(2-bromo-4-tert-butylphenoxy)-N-pentylbutanamide.
| Compound Name | 4-(2-bromo-4-tert-butylphenoxy)-N-pentylbutanamide |
|---|---|
| PubChem CID | 19201307 |
| Molecular Formula | C19H30BrNO2 |
| Molecular Weight | 384.36 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | 4-(2-bromo-4-tert-butylphenoxy)-N-pentylbutanamide |
| SMILES | CCCCCNC(=O)CCCOc1ccc(C(C)(C)C)cc1Br |
| InChI | InChI=1S/C19H30BrNO2/c1-5-6-7-12-21-18(22)9-8-13-23-17-11-10-15(14-16(17)20)19(2,3)4/h10-11,14H,5-9,12-13H2,1-4H3,(H,21,22) |
| InChIKey | BJKCNZVPZQSGAR-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.36 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|