C24H31Br2NO2 — CID 53267642
4-(2-bromo-4-tert-butylphenoxy)-N-(2-bromo-4-butylphenyl)butanamide (PubChem CID 53267642) has the molecular formula C24H31Br2NO2 and a molecular weight of 525.33 g/mol. Its IUPAC name is 4-(2-bromo-4-tert-butylphenoxy)-N-(2-bromo-4-butylphenyl)butanamide.
| Compound Name | 4-(2-bromo-4-tert-butylphenoxy)-N-(2-bromo-4-butylphenyl)butanamide |
|---|---|
| PubChem CID | 53267642 |
| Molecular Formula | C24H31Br2NO2 |
| Molecular Weight | 525.33 g/mol |
| Exact Mass | 523.07 |
| IUPAC Name | 4-(2-bromo-4-tert-butylphenoxy)-N-(2-bromo-4-butylphenyl)butanamide |
| SMILES | CCCCc1ccc(NC(=O)CCCOc2ccc(C(C)(C)C)cc2Br)c(Br)c1 |
| InChI | InChI=1S/C24H31Br2NO2/c1-5-6-8-17-10-12-21(19(25)15-17)27-23(28)9-7-14-29-22-13-11-18(16-20(22)26)24(2,3)4/h10-13,15-16H,5-9,14H2,1-4H3,(H,27,28) |
| InChIKey | LTWIZSGMNGMMOL-UHFFFAOYSA-N |
| XLogP | 7.65 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.33 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|