C25H32BrNO4 — CID 19201838
butyl 3-[4-(2-bromo-4-tert-butylphenoxy)butanoylamino]benzoate (PubChem CID 19201838) has the molecular formula C25H32BrNO4 and a molecular weight of 490.44 g/mol. Its IUPAC name is butyl 3-[4-(2-bromo-4-tert-butylphenoxy)butanoylamino]benzoate.
| Compound Name | butyl 3-[4-(2-bromo-4-tert-butylphenoxy)butanoylamino]benzoate |
|---|---|
| PubChem CID | 19201838 |
| Molecular Formula | C25H32BrNO4 |
| Molecular Weight | 490.44 g/mol |
| Exact Mass | 489.15 |
| IUPAC Name | butyl 3-[4-(2-bromo-4-tert-butylphenoxy)butanoylamino]benzoate |
| SMILES | CCCCOC(=O)c1cccc(NC(=O)CCCOc2ccc(C(C)(C)C)cc2Br)c1 |
| InChI | InChI=1S/C25H32BrNO4/c1-5-6-14-31-24(29)18-9-7-10-20(16-18)27-23(28)11-8-15-30-22-13-12-19(17-21(22)26)25(2,3)4/h7,9-10,12-13,16-17H,5-6,8,11,14-15H2,1-4H3,(H,27,28) |
| InChIKey | ZSYYNDXLUPTBQR-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.44 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|