C22H27NO5 — CID 19180963
butyl 3-[4-(2-methoxyphenoxy)butanoylamino]benzoate (PubChem CID 19180963) has the molecular formula C22H27NO5 and a molecular weight of 385.46 g/mol. Its IUPAC name is butyl 3-[4-(2-methoxyphenoxy)butanoylamino]benzoate.
| Compound Name | butyl 3-[4-(2-methoxyphenoxy)butanoylamino]benzoate |
|---|---|
| PubChem CID | 19180963 |
| Molecular Formula | C22H27NO5 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | butyl 3-[4-(2-methoxyphenoxy)butanoylamino]benzoate |
| SMILES | CCCCOC(=O)c1cccc(NC(=O)CCCOc2ccccc2OC)c1 |
| InChI | InChI=1S/C22H27NO5/c1-3-4-14-28-22(25)17-9-7-10-18(16-17)23-21(24)13-8-15-27-20-12-6-5-11-19(20)26-2/h5-7,9-12,16H,3-4,8,13-15H2,1-2H3,(H,23,24) |
| InChIKey | LVIQBRLTHUXLLV-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|