C25H30N2O6 — CID 84566637
propyl 3-[3-[cyclopropyl-[2-(2-methoxyphenoxy)acetyl]amino]propanoylamino]benzoate (PubChem CID 84566637) has the molecular formula C25H30N2O6 and a molecular weight of 454.52 g/mol. Its IUPAC name is propyl 3-[3-[cyclopropyl-[2-(2-methoxyphenoxy)acetyl]amino]propanoylamino]benzoate.
| Compound Name | propyl 3-[3-[cyclopropyl-[2-(2-methoxyphenoxy)acetyl]amino]propanoylamino]benzoate |
|---|---|
| PubChem CID | 84566637 |
| Molecular Formula | C25H30N2O6 |
| Molecular Weight | 454.52 g/mol |
| Exact Mass | 454.21 |
| IUPAC Name | propyl 3-[3-[cyclopropyl-[2-(2-methoxyphenoxy)acetyl]amino]propanoylamino]benzoate |
| SMILES | CCCOC(=O)c1cccc(NC(=O)CCN(C(=O)COc2ccccc2OC)C2CC2)c1 |
| InChI | InChI=1S/C25H30N2O6/c1-3-15-32-25(30)18-7-6-8-19(16-18)26-23(28)13-14-27(20-11-12-20)24(29)17-33-22-10-5-4-9-21(22)31-2/h4-10,16,20H,3,11-15,17H2,1-2H3,(H,26,28) |
| InChIKey | UNCYPSKBAVBGHY-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.52 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |