C22H24N2O7 — CID 84566023
5-[3-[cyclopropyl-[2-(2-methoxyphenoxy)acetyl]amino]propanoylamino]-2-hydroxybenzoic acid (PubChem CID 84566023) has the molecular formula C22H24N2O7 and a molecular weight of 428.44 g/mol. Its IUPAC name is 5-[3-[cyclopropyl-[2-(2-methoxyphenoxy)acetyl]amino]propanoylamino]-2-hydroxybenzoic acid.
| Compound Name | 5-[3-[cyclopropyl-[2-(2-methoxyphenoxy)acetyl]amino]propanoylamino]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 84566023 |
| Molecular Formula | C22H24N2O7 |
| Molecular Weight | 428.44 g/mol |
| Exact Mass | 428.16 |
| IUPAC Name | 5-[3-[cyclopropyl-[2-(2-methoxyphenoxy)acetyl]amino]propanoylamino]-2-hydroxybenzoic acid |
| SMILES | COc1ccccc1OCC(=O)N(CCC(=O)Nc1ccc(O)c(C(=O)O)c1)C1CC1 |
| InChI | InChI=1S/C22H24N2O7/c1-30-18-4-2-3-5-19(18)31-13-21(27)24(15-7-8-15)11-10-20(26)23-14-6-9-17(25)16(12-14)22(28)29/h2-6,9,12,15,25H,7-8,10-11,13H2,1H3,(H,23,26)(H,28,29) |
| InChIKey | SQEFMCZBBWQEAD-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 125.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.44 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|