C23H26N2O6 — CID 84565799
2-[3-[cyclopropyl-[2-(2-methoxyphenoxy)acetyl]amino]propanoylamino]-2-phenylacetic acid (PubChem CID 84565799) has the molecular formula C23H26N2O6 and a molecular weight of 426.47 g/mol. Its IUPAC name is 2-[3-[cyclopropyl-[2-(2-methoxyphenoxy)acetyl]amino]propanoylamino]-2-phenylacetic acid.
| Compound Name | 2-[3-[cyclopropyl-[2-(2-methoxyphenoxy)acetyl]amino]propanoylamino]-2-phenylacetic acid |
|---|---|
| PubChem CID | 84565799 |
| Molecular Formula | C23H26N2O6 |
| Molecular Weight | 426.47 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | 2-[3-[cyclopropyl-[2-(2-methoxyphenoxy)acetyl]amino]propanoylamino]-2-phenylacetic acid |
| SMILES | COc1ccccc1OCC(=O)N(CCC(=O)NC(C(=O)O)c1ccccc1)C1CC1 |
| InChI | InChI=1S/C23H26N2O6/c1-30-18-9-5-6-10-19(18)31-15-21(27)25(17-11-12-17)14-13-20(26)24-22(23(28)29)16-7-3-2-4-8-16/h2-10,17,22H,11-15H2,1H3,(H,24,26)(H,28,29) |
| InChIKey | VUMNFBHSPNBNJG-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.47 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |