C20H23NO5 — CID 19165843
butyl 3-[[2-(2-methoxyphenoxy)acetyl]amino]benzoate (PubChem CID 19165843) has the molecular formula C20H23NO5 and a molecular weight of 357.41 g/mol. Its IUPAC name is butyl 3-[[2-(2-methoxyphenoxy)acetyl]amino]benzoate.
| Compound Name | butyl 3-[[2-(2-methoxyphenoxy)acetyl]amino]benzoate |
|---|---|
| PubChem CID | 19165843 |
| Molecular Formula | C20H23NO5 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | butyl 3-[[2-(2-methoxyphenoxy)acetyl]amino]benzoate |
| SMILES | CCCCOC(=O)c1cccc(NC(=O)COc2ccccc2OC)c1 |
| InChI | InChI=1S/C20H23NO5/c1-3-4-12-25-20(23)15-8-7-9-16(13-15)21-19(22)14-26-18-11-6-5-10-17(18)24-2/h5-11,13H,3-4,12,14H2,1-2H3,(H,21,22) |
| InChIKey | OCYRPNYTEBTSTK-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|