C21H27NO4 — CID 17094764
N-(3-hexoxyphenyl)-2-(2-methoxyphenoxy)acetamide (PubChem CID 17094764) has the molecular formula C21H27NO4 and a molecular weight of 357.45 g/mol. Its IUPAC name is N-(3-hexoxyphenyl)-2-(2-methoxyphenoxy)acetamide.
| Compound Name | N-(3-hexoxyphenyl)-2-(2-methoxyphenoxy)acetamide |
|---|---|
| PubChem CID | 17094764 |
| Molecular Formula | C21H27NO4 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.19 |
| IUPAC Name | N-(3-hexoxyphenyl)-2-(2-methoxyphenoxy)acetamide |
| SMILES | CCCCCCOc1cccc(NC(=O)COc2ccccc2OC)c1 |
| InChI | InChI=1S/C21H27NO4/c1-3-4-5-8-14-25-18-11-9-10-17(15-18)22-21(23)16-26-20-13-7-6-12-19(20)24-2/h6-7,9-13,15H,3-5,8,14,16H2,1-2H3,(H,22,23) |
| InChIKey | RKGHVMHBPUGEFT-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|