C13H20N2O2 — CID 102387253
(3-hexoxyphenyl)urea (PubChem CID 102387253) has the molecular formula C13H20N2O2 and a molecular weight of 236.31 g/mol. Its IUPAC name is (3-hexoxyphenyl)urea.
| Compound Name | (3-hexoxyphenyl)urea |
|---|---|
| PubChem CID | 102387253 |
| Molecular Formula | C13H20N2O2 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.15 |
| IUPAC Name | (3-hexoxyphenyl)urea |
| SMILES | CCCCCCOc1cccc(NC(N)=O)c1 |
| InChI | InChI=1S/C13H20N2O2/c1-2-3-4-5-9-17-12-8-6-7-11(10-12)15-13(14)16/h6-8,10H,2-5,9H2,1H3,(H3,14,15,16) |
| InChIKey | IYLDPKYDMLYPAZ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|