C33H50N2O4 — CID 17094975
N,N'-bis(3-hexoxyphenyl)nonanediamide (PubChem CID 17094975) has the molecular formula C33H50N2O4 and a molecular weight of 538.77 g/mol. Its IUPAC name is N,N'-bis(3-hexoxyphenyl)nonanediamide.
| Compound Name | N,N'-bis(3-hexoxyphenyl)nonanediamide |
|---|---|
| PubChem CID | 17094975 |
| Molecular Formula | C33H50N2O4 |
| Molecular Weight | 538.77 g/mol |
| Exact Mass | 538.38 |
| IUPAC Name | N,N'-bis(3-hexoxyphenyl)nonanediamide |
| SMILES | CCCCCCOc1cccc(NC(=O)CCCCCCCC(=O)Nc2cccc(OCCCCCC)c2)c1 |
| InChI | InChI=1S/C33H50N2O4/c1-3-5-7-14-24-38-30-20-16-18-28(26-30)34-32(36)22-12-10-9-11-13-23-33(37)35-29-19-17-21-31(27-29)39-25-15-8-6-4-2/h16-21,26-27H,3-15,22-25H2,1-2H3,(H,34,36)(H,35,37) |
| InChIKey | HNWONQMTXPDJGP-UHFFFAOYSA-N |
| XLogP | 8.91 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.77 |
| LogP ≤ 5 | 8.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|