C24H28BrN3O3 — CID 108923977
4-(2-bromo-4-tert-butylphenoxy)-N-[[3-[(2-cyanoacetyl)amino]phenyl]methyl]butanamide (PubChem CID 108923977) has the molecular formula C24H28BrN3O3 and a molecular weight of 486.41 g/mol. Its IUPAC name is 4-(2-bromo-4-tert-butylphenoxy)-N-[[3-[(2-cyanoacetyl)amino]phenyl]methyl]butanamide.
| Compound Name | 4-(2-bromo-4-tert-butylphenoxy)-N-[[3-[(2-cyanoacetyl)amino]phenyl]methyl]butanamide |
|---|---|
| PubChem CID | 108923977 |
| Molecular Formula | C24H28BrN3O3 |
| Molecular Weight | 486.41 g/mol |
| Exact Mass | 485.13 |
| IUPAC Name | 4-(2-bromo-4-tert-butylphenoxy)-N-[[3-[(2-cyanoacetyl)amino]phenyl]methyl]butanamide |
| SMILES | CC(C)(C)c1ccc(OCCCC(=O)NCc2cccc(NC(=O)CC#N)c2)c(Br)c1 |
| InChI | InChI=1S/C24H28BrN3O3/c1-24(2,3)18-9-10-21(20(25)15-18)31-13-5-8-22(29)27-16-17-6-4-7-19(14-17)28-23(30)11-12-26/h4,6-7,9-10,14-15H,5,8,11,13,16H2,1-3H3,(H,27,29)(H,28,30) |
| InChIKey | DPDCYORCCXDORF-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 91.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.41 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|