C22H28BrNO2 — CID 19201525
4-(2-bromo-4-tert-butylphenoxy)-N-(3,4-dimethylphenyl)butanamide (PubChem CID 19201525) has the molecular formula C22H28BrNO2 and a molecular weight of 418.38 g/mol. Its IUPAC name is 4-(2-bromo-4-tert-butylphenoxy)-N-(3,4-dimethylphenyl)butanamide.
| Compound Name | 4-(2-bromo-4-tert-butylphenoxy)-N-(3,4-dimethylphenyl)butanamide |
|---|---|
| PubChem CID | 19201525 |
| Molecular Formula | C22H28BrNO2 |
| Molecular Weight | 418.38 g/mol |
| Exact Mass | 417.13 |
| IUPAC Name | 4-(2-bromo-4-tert-butylphenoxy)-N-(3,4-dimethylphenyl)butanamide |
| SMILES | Cc1ccc(NC(=O)CCCOc2ccc(C(C)(C)C)cc2Br)cc1C |
| InChI | InChI=1S/C22H28BrNO2/c1-15-8-10-18(13-16(15)2)24-21(25)7-6-12-26-20-11-9-17(14-19(20)23)22(3,4)5/h8-11,13-14H,6-7,12H2,1-5H3,(H,24,25) |
| InChIKey | NGFBMRBXACINES-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.38 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|