C24H32BrNO2 — CID 19201575
4-(2-bromo-4-tert-butylphenoxy)-N-(4-butylphenyl)butanamide (PubChem CID 19201575) has the molecular formula C24H32BrNO2 and a molecular weight of 446.43 g/mol. Its IUPAC name is 4-(2-bromo-4-tert-butylphenoxy)-N-(4-butylphenyl)butanamide.
| Compound Name | 4-(2-bromo-4-tert-butylphenoxy)-N-(4-butylphenyl)butanamide |
|---|---|
| PubChem CID | 19201575 |
| Molecular Formula | C24H32BrNO2 |
| Molecular Weight | 446.43 g/mol |
| Exact Mass | 445.16 |
| IUPAC Name | 4-(2-bromo-4-tert-butylphenoxy)-N-(4-butylphenyl)butanamide |
| SMILES | CCCCc1ccc(NC(=O)CCCOc2ccc(C(C)(C)C)cc2Br)cc1 |
| InChI | InChI=1S/C24H32BrNO2/c1-5-6-8-18-10-13-20(14-11-18)26-23(27)9-7-16-28-22-15-12-19(17-21(22)25)24(2,3)4/h10-15,17H,5-9,16H2,1-4H3,(H,26,27) |
| InChIKey | HQINSWRYRDNWRL-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.43 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|