C17H22N4O4 — CID 108918277
tert-butyl N-[2-[[3-[(2-cyanoacetyl)amino]phenyl]methylamino]-2-oxoethyl]carbamate (PubChem CID 108918277) has the molecular formula C17H22N4O4 and a molecular weight of 346.39 g/mol. Its IUPAC name is tert-butyl N-[2-[[3-[(2-cyanoacetyl)amino]phenyl]methylamino]-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[3-[(2-cyanoacetyl)amino]phenyl]methylamino]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 108918277 |
| Molecular Formula | C17H22N4O4 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | tert-butyl N-[2-[[3-[(2-cyanoacetyl)amino]phenyl]methylamino]-2-oxoethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(=O)NCc1cccc(NC(=O)CC#N)c1 |
| InChI | InChI=1S/C17H22N4O4/c1-17(2,3)25-16(24)20-11-15(23)19-10-12-5-4-6-13(9-12)21-14(22)7-8-18/h4-6,9H,7,10-11H2,1-3H3,(H,19,23)(H,20,24)(H,21,22) |
| InChIKey | HZAKWOADVYRLIL-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 120.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |