C22H27N3O4 — CID 108918514
tert-butyl N-[2-[[3-[(2-methylbenzoyl)amino]phenyl]methylamino]-2-oxoethyl]carbamate (PubChem CID 108918514) has the molecular formula C22H27N3O4 and a molecular weight of 397.48 g/mol. Its IUPAC name is tert-butyl N-[2-[[3-[(2-methylbenzoyl)amino]phenyl]methylamino]-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[3-[(2-methylbenzoyl)amino]phenyl]methylamino]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 108918514 |
| Molecular Formula | C22H27N3O4 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | tert-butyl N-[2-[[3-[(2-methylbenzoyl)amino]phenyl]methylamino]-2-oxoethyl]carbamate |
| SMILES | Cc1ccccc1C(=O)Nc1cccc(CNC(=O)CNC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C22H27N3O4/c1-15-8-5-6-11-18(15)20(27)25-17-10-7-9-16(12-17)13-23-19(26)14-24-21(28)29-22(2,3)4/h5-12H,13-14H2,1-4H3,(H,23,26)(H,24,28)(H,25,27) |
| InChIKey | ZLIUYMOBTCXPEO-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |