C23H30BrNO — CID 53267643
N-(2-bromo-4-butylphenyl)-3-(4-tert-butylphenyl)propanamide (PubChem CID 53267643) has the molecular formula C23H30BrNO and a molecular weight of 416.40 g/mol. Its IUPAC name is N-(2-bromo-4-butylphenyl)-3-(4-tert-butylphenyl)propanamide.
| Compound Name | N-(2-bromo-4-butylphenyl)-3-(4-tert-butylphenyl)propanamide |
|---|---|
| PubChem CID | 53267643 |
| Molecular Formula | C23H30BrNO |
| Molecular Weight | 416.40 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | N-(2-bromo-4-butylphenyl)-3-(4-tert-butylphenyl)propanamide |
| SMILES | CCCCc1ccc(NC(=O)CCc2ccc(C(C)(C)C)cc2)c(Br)c1 |
| InChI | InChI=1S/C23H30BrNO/c1-5-6-7-18-10-14-21(20(24)16-18)25-22(26)15-11-17-8-12-19(13-9-17)23(2,3)4/h8-10,12-14,16H,5-7,11,15H2,1-4H3,(H,25,26) |
| InChIKey | NWPYCXMDXQXBJI-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.40 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |