C18H24BrF3N2O3 — CID 108932581
4-(2-bromo-4-tert-butylphenoxy)-N-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]butanamide (PubChem CID 108932581) has the molecular formula C18H24BrF3N2O3 and a molecular weight of 453.30 g/mol. Its IUPAC name is 4-(2-bromo-4-tert-butylphenoxy)-N-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]butanamide.
| Compound Name | 4-(2-bromo-4-tert-butylphenoxy)-N-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]butanamide |
|---|---|
| PubChem CID | 108932581 |
| Molecular Formula | C18H24BrF3N2O3 |
| Molecular Weight | 453.30 g/mol |
| Exact Mass | 452.09 |
| IUPAC Name | 4-(2-bromo-4-tert-butylphenoxy)-N-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]butanamide |
| SMILES | CC(C)(C)c1ccc(OCCCC(=O)NCCNC(=O)C(F)(F)F)c(Br)c1 |
| InChI | InChI=1S/C18H24BrF3N2O3/c1-17(2,3)12-6-7-14(13(19)11-12)27-10-4-5-15(25)23-8-9-24-16(26)18(20,21)22/h6-7,11H,4-5,8-10H2,1-3H3,(H,23,25)(H,24,26) |
| InChIKey | VMXKVRCVWYGDGA-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.30 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|