C22H29BrN2O2 — CID 108882159
1-[3-(2-bromo-4-tert-butylphenoxy)propyl]-3-(3,5-dimethylphenyl)urea (PubChem CID 108882159) has the molecular formula C22H29BrN2O2 and a molecular weight of 433.39 g/mol. Its IUPAC name is 1-[3-(2-bromo-4-tert-butylphenoxy)propyl]-3-(3,5-dimethylphenyl)urea.
| Compound Name | 1-[3-(2-bromo-4-tert-butylphenoxy)propyl]-3-(3,5-dimethylphenyl)urea |
|---|---|
| PubChem CID | 108882159 |
| Molecular Formula | C22H29BrN2O2 |
| Molecular Weight | 433.39 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | 1-[3-(2-bromo-4-tert-butylphenoxy)propyl]-3-(3,5-dimethylphenyl)urea |
| SMILES | Cc1cc(C)cc(NC(=O)NCCCOc2ccc(C(C)(C)C)cc2Br)c1 |
| InChI | InChI=1S/C22H29BrN2O2/c1-15-11-16(2)13-18(12-15)25-21(26)24-9-6-10-27-20-8-7-17(14-19(20)23)22(3,4)5/h7-8,11-14H,6,9-10H2,1-5H3,(H2,24,25,26) |
| InChIKey | IEGANLBUQYWGCI-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.39 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|