C21H33BrN2O2 — CID 108882155
1-[3-(2-bromo-4-tert-butylphenoxy)propyl]-3-cycloheptylurea (PubChem CID 108882155) has the molecular formula C21H33BrN2O2 and a molecular weight of 425.41 g/mol. Its IUPAC name is 1-[3-(2-bromo-4-tert-butylphenoxy)propyl]-3-cycloheptylurea.
| Compound Name | 1-[3-(2-bromo-4-tert-butylphenoxy)propyl]-3-cycloheptylurea |
|---|---|
| PubChem CID | 108882155 |
| Molecular Formula | C21H33BrN2O2 |
| Molecular Weight | 425.41 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | 1-[3-(2-bromo-4-tert-butylphenoxy)propyl]-3-cycloheptylurea |
| SMILES | CC(C)(C)c1ccc(OCCCNC(=O)NC2CCCCCC2)c(Br)c1 |
| InChI | InChI=1S/C21H33BrN2O2/c1-21(2,3)16-11-12-19(18(22)15-16)26-14-8-13-23-20(25)24-17-9-6-4-5-7-10-17/h11-12,15,17H,4-10,13-14H2,1-3H3,(H2,23,24,25) |
| InChIKey | MDVNBSXIGNUQIJ-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.41 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|