C22H29BrN2O3 — CID 108881939
1-[3-(2-bromo-4-tert-butylphenoxy)propyl]-3-[2-(4-hydroxyphenyl)ethyl]urea (PubChem CID 108881939) has the molecular formula C22H29BrN2O3 and a molecular weight of 449.39 g/mol. Its IUPAC name is 1-[3-(2-bromo-4-tert-butylphenoxy)propyl]-3-[2-(4-hydroxyphenyl)ethyl]urea.
| Compound Name | 1-[3-(2-bromo-4-tert-butylphenoxy)propyl]-3-[2-(4-hydroxyphenyl)ethyl]urea |
|---|---|
| PubChem CID | 108881939 |
| Molecular Formula | C22H29BrN2O3 |
| Molecular Weight | 449.39 g/mol |
| Exact Mass | 448.14 |
| IUPAC Name | 1-[3-(2-bromo-4-tert-butylphenoxy)propyl]-3-[2-(4-hydroxyphenyl)ethyl]urea |
| SMILES | CC(C)(C)c1ccc(OCCCNC(=O)NCCc2ccc(O)cc2)c(Br)c1 |
| InChI | InChI=1S/C22H29BrN2O3/c1-22(2,3)17-7-10-20(19(23)15-17)28-14-4-12-24-21(27)25-13-11-16-5-8-18(26)9-6-16/h5-10,15,26H,4,11-14H2,1-3H3,(H2,24,25,27) |
| InChIKey | HAUDCNWGBNFSLL-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.39 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|