C21H28BrN3O2 — CID 108882215
1-(2-amino-4-methylphenyl)-3-[3-(2-bromo-4-tert-butylphenoxy)propyl]urea (PubChem CID 108882215) has the molecular formula C21H28BrN3O2 and a molecular weight of 434.38 g/mol. Its IUPAC name is 1-(2-amino-4-methylphenyl)-3-[3-(2-bromo-4-tert-butylphenoxy)propyl]urea.
| Compound Name | 1-(2-amino-4-methylphenyl)-3-[3-(2-bromo-4-tert-butylphenoxy)propyl]urea |
|---|---|
| PubChem CID | 108882215 |
| Molecular Formula | C21H28BrN3O2 |
| Molecular Weight | 434.38 g/mol |
| Exact Mass | 433.14 |
| IUPAC Name | 1-(2-amino-4-methylphenyl)-3-[3-(2-bromo-4-tert-butylphenoxy)propyl]urea |
| SMILES | Cc1ccc(NC(=O)NCCCOc2ccc(C(C)(C)C)cc2Br)c(N)c1 |
| InChI | InChI=1S/C21H28BrN3O2/c1-14-6-8-18(17(23)12-14)25-20(26)24-10-5-11-27-19-9-7-15(13-16(19)22)21(2,3)4/h6-9,12-13H,5,10-11,23H2,1-4H3,(H2,24,25,26) |
| InChIKey | WNVRLOJEMHVRCD-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.38 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|