C21H24BrF3N2O2 — CID 108881922
1-[3-(2-bromo-4-tert-butylphenoxy)propyl]-3-[2-(trifluoromethyl)phenyl]urea (PubChem CID 108881922) has the molecular formula C21H24BrF3N2O2 and a molecular weight of 473.33 g/mol. Its IUPAC name is 1-[3-(2-bromo-4-tert-butylphenoxy)propyl]-3-[2-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[3-(2-bromo-4-tert-butylphenoxy)propyl]-3-[2-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 108881922 |
| Molecular Formula | C21H24BrF3N2O2 |
| Molecular Weight | 473.33 g/mol |
| Exact Mass | 472.10 |
| IUPAC Name | 1-[3-(2-bromo-4-tert-butylphenoxy)propyl]-3-[2-(trifluoromethyl)phenyl]urea |
| SMILES | CC(C)(C)c1ccc(OCCCNC(=O)Nc2ccccc2C(F)(F)F)c(Br)c1 |
| InChI | InChI=1S/C21H24BrF3N2O2/c1-20(2,3)14-9-10-18(16(22)13-14)29-12-6-11-26-19(28)27-17-8-5-4-7-15(17)21(23,24)25/h4-5,7-10,13H,6,11-12H2,1-3H3,(H2,26,27,28) |
| InChIKey | JVCGHMXLBASBTO-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.33 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|