C23H26BrF3N2O3 — CID 108934109
4-(2-bromo-4-tert-butylphenoxy)-N-[2-[[(2,2,2-trifluoroacetyl)amino]methyl]phenyl]butanamide (PubChem CID 108934109) has the molecular formula C23H26BrF3N2O3 and a molecular weight of 515.37 g/mol. Its IUPAC name is 4-(2-bromo-4-tert-butylphenoxy)-N-[2-[[(2,2,2-trifluoroacetyl)amino]methyl]phenyl]butanamide.
| Compound Name | 4-(2-bromo-4-tert-butylphenoxy)-N-[2-[[(2,2,2-trifluoroacetyl)amino]methyl]phenyl]butanamide |
|---|---|
| PubChem CID | 108934109 |
| Molecular Formula | C23H26BrF3N2O3 |
| Molecular Weight | 515.37 g/mol |
| Exact Mass | 514.11 |
| IUPAC Name | 4-(2-bromo-4-tert-butylphenoxy)-N-[2-[[(2,2,2-trifluoroacetyl)amino]methyl]phenyl]butanamide |
| SMILES | CC(C)(C)c1ccc(OCCCC(=O)Nc2ccccc2CNC(=O)C(F)(F)F)c(Br)c1 |
| InChI | InChI=1S/C23H26BrF3N2O3/c1-22(2,3)16-10-11-19(17(24)13-16)32-12-6-9-20(30)29-18-8-5-4-7-15(18)14-28-21(31)23(25,26)27/h4-5,7-8,10-11,13H,6,9,12,14H2,1-3H3,(H,28,31)(H,29,30) |
| InChIKey | SSIDYTBTQMBLMB-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.37 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|