C20H23BrCl2N2O2 — CID 108881928
1-[3-(2-bromo-4-tert-butylphenoxy)propyl]-3-(2,3-dichlorophenyl)urea (PubChem CID 108881928) has the molecular formula C20H23BrCl2N2O2 and a molecular weight of 474.23 g/mol. Its IUPAC name is 1-[3-(2-bromo-4-tert-butylphenoxy)propyl]-3-(2,3-dichlorophenyl)urea.
| Compound Name | 1-[3-(2-bromo-4-tert-butylphenoxy)propyl]-3-(2,3-dichlorophenyl)urea |
|---|---|
| PubChem CID | 108881928 |
| Molecular Formula | C20H23BrCl2N2O2 |
| Molecular Weight | 474.23 g/mol |
| Exact Mass | 472.03 |
| IUPAC Name | 1-[3-(2-bromo-4-tert-butylphenoxy)propyl]-3-(2,3-dichlorophenyl)urea |
| SMILES | CC(C)(C)c1ccc(OCCCNC(=O)Nc2cccc(Cl)c2Cl)c(Br)c1 |
| InChI | InChI=1S/C20H23BrCl2N2O2/c1-20(2,3)13-8-9-17(14(21)12-13)27-11-5-10-24-19(26)25-16-7-4-6-15(22)18(16)23/h4,6-9,12H,5,10-11H2,1-3H3,(H2,24,25,26) |
| InChIKey | PJOXOPAJDZTRJJ-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.23 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|