C18H24BrN3O3 — CID 108882078
1-[3-(2-bromo-4-tert-butylphenoxy)propyl]-3-(5-methyl-1,2-oxazol-3-yl)urea (PubChem CID 108882078) has the molecular formula C18H24BrN3O3 and a molecular weight of 410.31 g/mol. Its IUPAC name is 1-[3-(2-bromo-4-tert-butylphenoxy)propyl]-3-(5-methyl-1,2-oxazol-3-yl)urea.
| Compound Name | 1-[3-(2-bromo-4-tert-butylphenoxy)propyl]-3-(5-methyl-1,2-oxazol-3-yl)urea |
|---|---|
| PubChem CID | 108882078 |
| Molecular Formula | C18H24BrN3O3 |
| Molecular Weight | 410.31 g/mol |
| Exact Mass | 409.10 |
| IUPAC Name | 1-[3-(2-bromo-4-tert-butylphenoxy)propyl]-3-(5-methyl-1,2-oxazol-3-yl)urea |
| SMILES | Cc1cc(NC(=O)NCCCOc2ccc(C(C)(C)C)cc2Br)no1 |
| InChI | InChI=1S/C18H24BrN3O3/c1-12-10-16(22-25-12)21-17(23)20-8-5-9-24-15-7-6-13(11-14(15)19)18(2,3)4/h6-7,10-11H,5,8-9H2,1-4H3,(H2,20,21,22,23) |
| InChIKey | TUUZOYOUNRQXIX-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 76.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.31 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|