C24H38BrN3O4 — CID 108882271
tert-butyl 4-[3-(2-bromo-4-tert-butylphenoxy)propylcarbamoylamino]piperidine-1-carboxylate (PubChem CID 108882271) has the molecular formula C24H38BrN3O4 and a molecular weight of 512.49 g/mol. Its IUPAC name is tert-butyl 4-[3-(2-bromo-4-tert-butylphenoxy)propylcarbamoylamino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-(2-bromo-4-tert-butylphenoxy)propylcarbamoylamino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 108882271 |
| Molecular Formula | C24H38BrN3O4 |
| Molecular Weight | 512.49 g/mol |
| Exact Mass | 511.20 |
| IUPAC Name | tert-butyl 4-[3-(2-bromo-4-tert-butylphenoxy)propylcarbamoylamino]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(NC(=O)NCCCOc2ccc(C(C)(C)C)cc2Br)CC1 |
| InChI | InChI=1S/C24H38BrN3O4/c1-23(2,3)17-8-9-20(19(25)16-17)31-15-7-12-26-21(29)27-18-10-13-28(14-11-18)22(30)32-24(4,5)6/h8-9,16,18H,7,10-15H2,1-6H3,(H2,26,27,29) |
| InChIKey | UQNBKBYUNOYHKP-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.49 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|