C21H31BrN2O3 — CID 108561147
N-(1-acetylpiperidin-4-yl)-4-(2-bromo-4-tert-butylphenoxy)butanamide (PubChem CID 108561147) has the molecular formula C21H31BrN2O3 and a molecular weight of 439.39 g/mol. Its IUPAC name is N-(1-acetylpiperidin-4-yl)-4-(2-bromo-4-tert-butylphenoxy)butanamide.
| Compound Name | N-(1-acetylpiperidin-4-yl)-4-(2-bromo-4-tert-butylphenoxy)butanamide |
|---|---|
| PubChem CID | 108561147 |
| Molecular Formula | C21H31BrN2O3 |
| Molecular Weight | 439.39 g/mol |
| Exact Mass | 438.15 |
| IUPAC Name | N-(1-acetylpiperidin-4-yl)-4-(2-bromo-4-tert-butylphenoxy)butanamide |
| SMILES | CC(=O)N1CCC(NC(=O)CCCOc2ccc(C(C)(C)C)cc2Br)CC1 |
| InChI | InChI=1S/C21H31BrN2O3/c1-15(25)24-11-9-17(10-12-24)23-20(26)6-5-13-27-19-8-7-16(14-18(19)22)21(2,3)4/h7-8,14,17H,5-6,9-13H2,1-4H3,(H,23,26) |
| InChIKey | VHQZHVLETABCLC-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.39 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|