C19H29N3O4 — CID 108893156
tert-butyl 4-[(4-methylphenoxy)methylcarbamoylamino]piperidine-1-carboxylate (PubChem CID 108893156) has the molecular formula C19H29N3O4 and a molecular weight of 363.46 g/mol. Its IUPAC name is tert-butyl 4-[(4-methylphenoxy)methylcarbamoylamino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[(4-methylphenoxy)methylcarbamoylamino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 108893156 |
| Molecular Formula | C19H29N3O4 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.22 |
| IUPAC Name | tert-butyl 4-[(4-methylphenoxy)methylcarbamoylamino]piperidine-1-carboxylate |
| SMILES | Cc1ccc(OCNC(=O)NC2CCN(C(=O)OC(C)(C)C)CC2)cc1 |
| InChI | InChI=1S/C19H29N3O4/c1-14-5-7-16(8-6-14)25-13-20-17(23)21-15-9-11-22(12-10-15)18(24)26-19(2,3)4/h5-8,15H,9-13H2,1-4H3,(H2,20,21,23) |
| InChIKey | IZXNTRBXTZYZPO-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|