C23H35N3O5 — CID 108553401
tert-butyl N-[2-[4-[4-(4-methylphenoxy)butanoylamino]piperidin-1-yl]-2-oxoethyl]carbamate (PubChem CID 108553401) has the molecular formula C23H35N3O5 and a molecular weight of 433.55 g/mol. Its IUPAC name is tert-butyl N-[2-[4-[4-(4-methylphenoxy)butanoylamino]piperidin-1-yl]-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-[4-[4-(4-methylphenoxy)butanoylamino]piperidin-1-yl]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 108553401 |
| Molecular Formula | C23H35N3O5 |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.26 |
| IUPAC Name | tert-butyl N-[2-[4-[4-(4-methylphenoxy)butanoylamino]piperidin-1-yl]-2-oxoethyl]carbamate |
| SMILES | Cc1ccc(OCCCC(=O)NC2CCN(C(=O)CNC(=O)OC(C)(C)C)CC2)cc1 |
| InChI | InChI=1S/C23H35N3O5/c1-17-7-9-19(10-8-17)30-15-5-6-20(27)25-18-11-13-26(14-12-18)21(28)16-24-22(29)31-23(2,3)4/h7-10,18H,5-6,11-16H2,1-4H3,(H,24,29)(H,25,27) |
| InChIKey | XYOALKJMLDBPGU-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|