C21H33N3O4 — CID 108881535
tert-butyl 4-[3-(4-methylphenoxy)propylcarbamoylamino]piperidine-1-carboxylate (PubChem CID 108881535) has the molecular formula C21H33N3O4 and a molecular weight of 391.51 g/mol. Its IUPAC name is tert-butyl 4-[3-(4-methylphenoxy)propylcarbamoylamino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-(4-methylphenoxy)propylcarbamoylamino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 108881535 |
| Molecular Formula | C21H33N3O4 |
| Molecular Weight | 391.51 g/mol |
| Exact Mass | 391.25 |
| IUPAC Name | tert-butyl 4-[3-(4-methylphenoxy)propylcarbamoylamino]piperidine-1-carboxylate |
| SMILES | Cc1ccc(OCCCNC(=O)NC2CCN(C(=O)OC(C)(C)C)CC2)cc1 |
| InChI | InChI=1S/C21H33N3O4/c1-16-6-8-18(9-7-16)27-15-5-12-22-19(25)23-17-10-13-24(14-11-17)20(26)28-21(2,3)4/h6-9,17H,5,10-15H2,1-4H3,(H2,22,23,25) |
| InChIKey | HIKROLCAVWZXRC-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.51 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|