C16H30N4O5 — CID 108864537
ethyl 4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylcarbamoylamino]piperidine-1-carboxylate (PubChem CID 108864537) has the molecular formula C16H30N4O5 and a molecular weight of 358.44 g/mol. Its IUPAC name is ethyl 4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylcarbamoylamino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylcarbamoylamino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 108864537 |
| Molecular Formula | C16H30N4O5 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.22 |
| IUPAC Name | ethyl 4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylcarbamoylamino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(NC(=O)NCCNC(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C16H30N4O5/c1-5-24-15(23)20-10-6-12(7-11-20)19-13(21)17-8-9-18-14(22)25-16(2,3)4/h12H,5-11H2,1-4H3,(H,18,22)(H2,17,19,21) |
| InChIKey | LBNCNYSGQHANPB-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 109.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|