C16H30N4O4 — CID 108558938
tert-butyl N-[3-[[1-(dimethylcarbamoyl)piperidin-4-yl]amino]-3-oxopropyl]carbamate (PubChem CID 108558938) has the molecular formula C16H30N4O4 and a molecular weight of 342.44 g/mol. Its IUPAC name is tert-butyl N-[3-[[1-(dimethylcarbamoyl)piperidin-4-yl]amino]-3-oxopropyl]carbamate.
| Compound Name | tert-butyl N-[3-[[1-(dimethylcarbamoyl)piperidin-4-yl]amino]-3-oxopropyl]carbamate |
|---|---|
| PubChem CID | 108558938 |
| Molecular Formula | C16H30N4O4 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.23 |
| IUPAC Name | tert-butyl N-[3-[[1-(dimethylcarbamoyl)piperidin-4-yl]amino]-3-oxopropyl]carbamate |
| SMILES | CN(C)C(=O)N1CCC(NC(=O)CCNC(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C16H30N4O4/c1-16(2,3)24-14(22)17-9-6-13(21)18-12-7-10-20(11-8-12)15(23)19(4)5/h12H,6-11H2,1-5H3,(H,17,22)(H,18,21) |
| InChIKey | KSPQPXGIQHCYGI-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |