C15H28N4O4 — CID 108558901
tert-butyl N-[2-[[1-(dimethylcarbamoyl)piperidin-4-yl]amino]-2-oxoethyl]carbamate (PubChem CID 108558901) has the molecular formula C15H28N4O4 and a molecular weight of 328.41 g/mol. Its IUPAC name is tert-butyl N-[2-[[1-(dimethylcarbamoyl)piperidin-4-yl]amino]-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[1-(dimethylcarbamoyl)piperidin-4-yl]amino]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 108558901 |
| Molecular Formula | C15H28N4O4 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.21 |
| IUPAC Name | tert-butyl N-[2-[[1-(dimethylcarbamoyl)piperidin-4-yl]amino]-2-oxoethyl]carbamate |
| SMILES | CN(C)C(=O)N1CCC(NC(=O)CNC(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C15H28N4O4/c1-15(2,3)23-13(21)16-10-12(20)17-11-6-8-19(9-7-11)14(22)18(4)5/h11H,6-10H2,1-5H3,(H,16,21)(H,17,20) |
| InChIKey | CJJIAPDHYXNQCF-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |