C15H26ClN3O4 — CID 108558894
tert-butyl N-[2-[[1-(3-chloropropanoyl)piperidin-4-yl]amino]-2-oxoethyl]carbamate (PubChem CID 108558894) has the molecular formula C15H26ClN3O4 and a molecular weight of 347.84 g/mol. Its IUPAC name is tert-butyl N-[2-[[1-(3-chloropropanoyl)piperidin-4-yl]amino]-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[1-(3-chloropropanoyl)piperidin-4-yl]amino]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 108558894 |
| Molecular Formula | C15H26ClN3O4 |
| Molecular Weight | 347.84 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | tert-butyl N-[2-[[1-(3-chloropropanoyl)piperidin-4-yl]amino]-2-oxoethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(=O)NC1CCN(C(=O)CCCl)CC1 |
| InChI | InChI=1S/C15H26ClN3O4/c1-15(2,3)23-14(22)17-10-12(20)18-11-5-8-19(9-6-11)13(21)4-7-16/h11H,4-10H2,1-3H3,(H,17,22)(H,18,20) |
| InChIKey | CRGRNNKJZFVQQU-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.84 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|