C14H25N3O5 — CID 108558897
methyl 4-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]amino]piperidine-1-carboxylate (PubChem CID 108558897) has the molecular formula C14H25N3O5 and a molecular weight of 315.37 g/mol. Its IUPAC name is methyl 4-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]amino]piperidine-1-carboxylate.
| Compound Name | methyl 4-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 108558897 |
| Molecular Formula | C14H25N3O5 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.18 |
| IUPAC Name | methyl 4-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]amino]piperidine-1-carboxylate |
| SMILES | COC(=O)N1CCC(NC(=O)CNC(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C14H25N3O5/c1-14(2,3)22-12(19)15-9-11(18)16-10-5-7-17(8-6-10)13(20)21-4/h10H,5-9H2,1-4H3,(H,15,19)(H,16,18) |
| InChIKey | PGYLPWRSUBJHQP-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |