C17H25N3O5 — CID 108548132
tert-butyl N-[2-[[1-(furan-2-carbonyl)piperidin-4-yl]amino]-2-oxoethyl]carbamate (PubChem CID 108548132) has the molecular formula C17H25N3O5 and a molecular weight of 351.40 g/mol. Its IUPAC name is tert-butyl N-[2-[[1-(furan-2-carbonyl)piperidin-4-yl]amino]-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[1-(furan-2-carbonyl)piperidin-4-yl]amino]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 108548132 |
| Molecular Formula | C17H25N3O5 |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | tert-butyl N-[2-[[1-(furan-2-carbonyl)piperidin-4-yl]amino]-2-oxoethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(=O)NC1CCN(C(=O)c2ccco2)CC1 |
| InChI | InChI=1S/C17H25N3O5/c1-17(2,3)25-16(23)18-11-14(21)19-12-6-8-20(9-7-12)15(22)13-5-4-10-24-13/h4-5,10,12H,6-9,11H2,1-3H3,(H,18,23)(H,19,21) |
| InChIKey | RLZQYUFSWUYYBY-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 100.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |